C8H13NO2S2 — CID 52602693
4-(methylsulfonylmethyl)-2-propan-2-yl-1,3-thiazole (PubChem CID 52602693) has the molecular formula C8H13NO2S2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-2-propan-2-yl-1,3-thiazole.
| Compound Name | 4-(methylsulfonylmethyl)-2-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 52602693 |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 4-(methylsulfonylmethyl)-2-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1nc(CS(C)(=O)=O)cs1 |
| InChI | InChI=1S/C8H13NO2S2/c1-6(2)8-9-7(4-12-8)5-13(3,10)11/h4,6H,5H2,1-3H3 |
| InChIKey | VKKQKFCJQPYVRB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |