C10H16N2OS — CID 91286036
N-ethyl-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 91286036) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is N-ethyl-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-ethyl-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 91286036 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-ethyl-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCNC(=O)Cc1csc(C(C)C)n1 |
| InChI | InChI=1S/C10H16N2OS/c1-4-11-9(13)5-8-6-14-10(12-8)7(2)3/h6-7H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | PIBFWDLNWDJUSI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |