C13H19F3N2O2S — CID 86986102
2-(2-propan-2-yl-1,3-thiazol-4-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide (PubChem CID 86986102) has the molecular formula C13H19F3N2O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-(2-propan-2-yl-1,3-thiazol-4-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide.
| Compound Name | 2-(2-propan-2-yl-1,3-thiazol-4-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 86986102 |
| Molecular Formula | C13H19F3N2O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-(2-propan-2-yl-1,3-thiazol-4-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
| SMILES | CC(C)c1nc(CC(=O)NCCCOCC(F)(F)F)cs1 |
| InChI | InChI=1S/C13H19F3N2O2S/c1-9(2)12-18-10(7-21-12)6-11(19)17-4-3-5-20-8-13(14,15)16/h7,9H,3-6,8H2,1-2H3,(H,17,19) |
| InChIKey | IXSURKCMZCVQHM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|