C12H18F3N3O2 — CID 87016232
5-propan-2-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]-1H-pyrazole-3-carboxamide (PubChem CID 87016232) has the molecular formula C12H18F3N3O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is 5-propan-2-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-propan-2-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 87016232 |
| Molecular Formula | C12H18F3N3O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 5-propan-2-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NCCCOCC(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C12H18F3N3O2/c1-8(2)9-6-10(18-17-9)11(19)16-4-3-5-20-7-12(13,14)15/h6,8H,3-5,7H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | IWGCPKQTERGDOO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|