C12H19F3N4O — CID 19508355
N-[3-(diethylamino)propyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 19508355) has the molecular formula C12H19F3N4O and a molecular weight of 292.30 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19508355 |
| Molecular Formula | C12H19F3N4O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-[3-(diethylamino)propyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C12H19F3N4O/c1-3-19(4-2)7-5-6-16-11(20)9-8-10(18-17-9)12(13,14)15/h8H,3-7H2,1-2H3,(H,16,20)(H,17,18) |
| InChIKey | UCNAXEMRVSUNGU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|