C12H13F3N6O3 — CID 19282025
N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 19282025) has the molecular formula C12H13F3N6O3 and a molecular weight of 346.27 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19282025 |
| Molecular Formula | C12H13F3N6O3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1nn(CCNC(=O)c2cc(C(F)(F)F)[nH]n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13F3N6O3/c1-6-10(21(23)24)7(2)20(19-6)4-3-16-11(22)8-5-9(18-17-8)12(13,14)15/h5H,3-4H2,1-2H3,(H,16,22)(H,17,18) |
| InChIKey | YENDRLYBZRDWMW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|