C15H15F3N4O3 — CID 19282633
N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 19282633) has the molecular formula C15H15F3N4O3 and a molecular weight of 356.30 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 19282633 |
| Molecular Formula | C15H15F3N4O3 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1nn(CCNC(=O)c2cccc(C(F)(F)F)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15F3N4O3/c1-9-13(22(24)25)10(2)21(20-9)7-6-19-14(23)11-4-3-5-12(8-11)15(16,17)18/h3-5,8H,6-7H2,1-2H3,(H,19,23) |
| InChIKey | NKPDOQLYIQGUOQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|