C22H23ClN4O4 — CID 19282099
3-[(2-chloro-5-methylphenoxy)methyl]-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]benzamide (PubChem CID 19282099) has the molecular formula C22H23ClN4O4 and a molecular weight of 442.90 g/mol. Its IUPAC name is 3-[(2-chloro-5-methylphenoxy)methyl]-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]benzamide.
| Compound Name | 3-[(2-chloro-5-methylphenoxy)methyl]-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 19282099 |
| Molecular Formula | C22H23ClN4O4 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 3-[(2-chloro-5-methylphenoxy)methyl]-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]benzamide |
| SMILES | Cc1ccc(Cl)c(OCc2cccc(C(=O)NCCn3nc(C)c([N+](=O)[O-])c3C)c2)c1 |
| InChI | InChI=1S/C22H23ClN4O4/c1-14-7-8-19(23)20(11-14)31-13-17-5-4-6-18(12-17)22(28)24-9-10-26-16(3)21(27(29)30)15(2)25-26/h4-8,11-12H,9-10,13H2,1-3H3,(H,24,28) |
| InChIKey | POQISNVFVYZGCB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|