C24H28ClN3O2 — CID 19295534
N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-[(2,5-dimethylphenoxy)methyl]benzamide (PubChem CID 19295534) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-[(2,5-dimethylphenoxy)methyl]benzamide.
| Compound Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-[(2,5-dimethylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19295534 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-[(2,5-dimethylphenoxy)methyl]benzamide |
| SMILES | Cc1ccc(C)c(OCc2cccc(C(=O)NCCCn3nc(C)c(Cl)c3C)c2)c1 |
| InChI | InChI=1S/C24H28ClN3O2/c1-16-9-10-17(2)22(13-16)30-15-20-7-5-8-21(14-20)24(29)26-11-6-12-28-19(4)23(25)18(3)27-28/h5,7-10,13-14H,6,11-12,15H2,1-4H3,(H,26,29) |
| InChIKey | LMZFVWUKXLBVLE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|