C24H26F3N3O2 — CID 19295755
3-[(2,4-dimethylphenoxy)methyl]-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzamide (PubChem CID 19295755) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenoxy)methyl]-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzamide.
| Compound Name | 3-[(2,4-dimethylphenoxy)methyl]-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 19295755 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-[(2,4-dimethylphenoxy)methyl]-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzamide |
| SMILES | Cc1ccc(OCc2cccc(C(=O)NCCCn3nc(C(F)(F)F)cc3C)c2)c(C)c1 |
| InChI | InChI=1S/C24H26F3N3O2/c1-16-8-9-21(17(2)12-16)32-15-19-6-4-7-20(14-19)23(31)28-10-5-11-30-18(3)13-22(29-30)24(25,26)27/h4,6-9,12-14H,5,10-11,15H2,1-3H3,(H,28,31) |
| InChIKey | SWLVUPQOVWAEGH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|