C12H8F3N3O4 — CID 2820278
N-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-(trifluoromethyl)benzamide (PubChem CID 2820278) has the molecular formula C12H8F3N3O4 and a molecular weight of 315.21 g/mol. Its IUPAC name is N-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2820278 |
| Molecular Formula | C12H8F3N3O4 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-(trifluoromethyl)benzamide |
| SMILES | Cc1noc(NC(=O)c2cccc(C(F)(F)F)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8F3N3O4/c1-6-9(18(20)21)11(22-17-6)16-10(19)7-3-2-4-8(5-7)12(13,14)15/h2-5H,1H3,(H,16,19) |
| InChIKey | SPCOOIDCXXXWDP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|