C23H22F3N7O3 — CID 19282688
N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(3,4-dimethylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19282688) has the molecular formula C23H22F3N7O3 and a molecular weight of 501.47 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(3,4-dimethylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(3,4-dimethylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19282688 |
| Molecular Formula | C23H22F3N7O3 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(3,4-dimethylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)n3nc(C(=O)NCCn4nc(C)c([N+](=O)[O-])c4C)cc3n2)cc1C |
| InChI | InChI=1S/C23H22F3N7O3/c1-12-5-6-16(9-13(12)2)17-10-19(23(24,25)26)32-20(28-17)11-18(30-32)22(34)27-7-8-31-15(4)21(33(35)36)14(3)29-31/h5-6,9-11H,7-8H2,1-4H3,(H,27,34) |
| InChIKey | JZJOABAFJSRWID-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|