C15H15F4N3O2 — CID 86979261
5-(4-fluorophenyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]-1H-pyrazole-4-carboxamide (PubChem CID 86979261) has the molecular formula C15H15F4N3O2 and a molecular weight of 345.30 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86979261 |
| Molecular Formula | C15H15F4N3O2 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCCCOCC(F)(F)F)c1cn[nH]c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H15F4N3O2/c16-11-4-2-10(3-5-11)13-12(8-21-22-13)14(23)20-6-1-7-24-9-15(17,18)19/h2-5,8H,1,6-7,9H2,(H,20,23)(H,21,22) |
| InChIKey | RGCHZITWXSPQMZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|