C15H19ClF3NO3 — CID 86832151
5-chloro-2-propan-2-yloxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide (PubChem CID 86832151) has the molecular formula C15H19ClF3NO3 and a molecular weight of 353.77 g/mol. Its IUPAC name is 5-chloro-2-propan-2-yloxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide.
| Compound Name | 5-chloro-2-propan-2-yloxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 86832151 |
| Molecular Formula | C15H19ClF3NO3 |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 5-chloro-2-propan-2-yloxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide |
| SMILES | CC(C)Oc1ccc(Cl)cc1C(=O)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C15H19ClF3NO3/c1-10(2)23-13-5-4-11(16)8-12(13)14(21)20-6-3-7-22-9-15(17,18)19/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,20,21) |
| InChIKey | AVZSOWSVUVJGOP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|