C14H20ClNO3S — CID 71844288
5-chloro-N-(2-methylsulfinylpropyl)-2-propan-2-yloxybenzamide (PubChem CID 71844288) has the molecular formula C14H20ClNO3S and a molecular weight of 317.84 g/mol. Its IUPAC name is 5-chloro-N-(2-methylsulfinylpropyl)-2-propan-2-yloxybenzamide.
| Compound Name | 5-chloro-N-(2-methylsulfinylpropyl)-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 71844288 |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 5-chloro-N-(2-methylsulfinylpropyl)-2-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(Cl)cc1C(=O)NCC(C)S(C)=O |
| InChI | InChI=1S/C14H20ClNO3S/c1-9(2)19-13-6-5-11(15)7-12(13)14(17)16-8-10(3)20(4)18/h5-7,9-10H,8H2,1-4H3,(H,16,17) |
| InChIKey | JVOQSZOXOIFHDD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |