C12H20N2OS2 — CID 124852149
3-ethylsulfanyl-N-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)propyl]propanamide (PubChem CID 124852149) has the molecular formula C12H20N2OS2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 3-ethylsulfanyl-N-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)propyl]propanamide.
| Compound Name | 3-ethylsulfanyl-N-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 124852149 |
| Molecular Formula | C12H20N2OS2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-ethylsulfanyl-N-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)propyl]propanamide |
| SMILES | CCSCCC(=O)NC[C@@H](C)c1nc(C)cs1 |
| InChI | InChI=1S/C12H20N2OS2/c1-4-16-6-5-11(15)13-7-9(2)12-14-10(3)8-17-12/h8-9H,4-7H2,1-3H3,(H,13,15)/t9-/m1/s1 |
| InChIKey | UHRDAOIROZRLQS-SECBINFHSA-N |
| XLogP | 2.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|