C9H13BrN2OS — CID 82108654
3-bromo-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]propanamide (PubChem CID 82108654) has the molecular formula C9H13BrN2OS and a molecular weight of 277.19 g/mol. Its IUPAC name is 3-bromo-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]propanamide.
| Compound Name | 3-bromo-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 82108654 |
| Molecular Formula | C9H13BrN2OS |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 3-bromo-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]propanamide |
| SMILES | Cc1csc(C(C)NC(=O)CCBr)n1 |
| InChI | InChI=1S/C9H13BrN2OS/c1-6-5-14-9(11-6)7(2)12-8(13)3-4-10/h5,7H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | MEQFYUAANLWPML-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|