C15H25N3OS — CID 119875889
N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-piperidin-4-ylbutanamide (PubChem CID 119875889) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-piperidin-4-ylbutanamide.
| Compound Name | N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119875889 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-piperidin-4-ylbutanamide |
| SMILES | Cc1csc(C(C)NC(=O)CC(C)C2CCNCC2)n1 |
| InChI | InChI=1S/C15H25N3OS/c1-10(13-4-6-16-7-5-13)8-14(19)18-12(3)15-17-11(2)9-20-15/h9-10,12-13,16H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | OXLSTFSDAUFJOA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |