C17H22N4O2S — CID 75477530
N-ethyl-4-[2-(4-methyl-1,3-thiazol-2-yl)propylcarbamoylamino]benzamide (PubChem CID 75477530) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-ethyl-4-[2-(4-methyl-1,3-thiazol-2-yl)propylcarbamoylamino]benzamide.
| Compound Name | N-ethyl-4-[2-(4-methyl-1,3-thiazol-2-yl)propylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 75477530 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-ethyl-4-[2-(4-methyl-1,3-thiazol-2-yl)propylcarbamoylamino]benzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)NCC(C)c2nc(C)cs2)cc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-4-18-15(22)13-5-7-14(8-6-13)21-17(23)19-9-11(2)16-20-12(3)10-24-16/h5-8,10-11H,4,9H2,1-3H3,(H,18,22)(H2,19,21,23) |
| InChIKey | WLJZHSNJFHRMMC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |