C39H36N2O3S2 — CID 174437051
2,4-bis(4-methyl-1,3-thiazol-2-yl)-1,5-bis(4-phenylmethoxyphenyl)pentan-3-one (PubChem CID 174437051) has the molecular formula C39H36N2O3S2 and a molecular weight of 644.86 g/mol. Its IUPAC name is 2,4-bis(4-methyl-1,3-thiazol-2-yl)-1,5-bis(4-phenylmethoxyphenyl)pentan-3-one.
| Compound Name | 2,4-bis(4-methyl-1,3-thiazol-2-yl)-1,5-bis(4-phenylmethoxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 174437051 |
| Molecular Formula | C39H36N2O3S2 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | 2,4-bis(4-methyl-1,3-thiazol-2-yl)-1,5-bis(4-phenylmethoxyphenyl)pentan-3-one |
| SMILES | Cc1csc(C(Cc2ccc(OCc3ccccc3)cc2)C(=O)C(Cc2ccc(OCc3ccccc3)cc2)c2nc(C)cs2)n1 |
| InChI | InChI=1S/C39H36N2O3S2/c1-27-25-45-38(40-27)35(21-29-13-17-33(18-14-29)43-23-31-9-5-3-6-10-31)37(42)36(39-41-28(2)26-46-39)22-30-15-19-34(20-16-30)44-24-32-11-7-4-8-12-32/h3-20,25-26,35-36H,21-24H2,1-2H3 |
| InChIKey | KGOFTZIMISCYMB-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |