C35H38N2O4S — CID 145468962
ethyl (2Z,4E)-5-[2-[1-[(1-hydroxy-2-phenylethyl)amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 145468962) has the molecular formula C35H38N2O4S and a molecular weight of 582.77 g/mol. Its IUPAC name is ethyl (2Z,4E)-5-[2-[1-[(1-hydroxy-2-phenylethyl)amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-5-[2-[1-[(1-hydroxy-2-phenylethyl)amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 145468962 |
| Molecular Formula | C35H38N2O4S |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | ethyl (2Z,4E)-5-[2-[1-[(1-hydroxy-2-phenylethyl)amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C\C(C)=C\c1csc(C(Cc2ccc(OCc3ccccc3)cc2)NC(O)Cc2ccccc2)n1 |
| InChI | InChI=1S/C35H38N2O4S/c1-4-40-35(39)26(3)19-25(2)20-30-24-42-34(36-30)32(37-33(38)22-27-11-7-5-8-12-27)21-28-15-17-31(18-16-28)41-23-29-13-9-6-10-14-29/h5-20,24,32-33,37-38H,4,21-23H2,1-3H3/b25-20+,26-19- |
| InChIKey | ZMQGUYNIZSZQGR-YDDSEVMSSA-N |
| XLogP | 7.07 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|