C28H32N2O3S — CID 145468972
ethyl (2Z,4E)-5-[2-[1-amino-2-[4-(2-phenylethoxy)phenyl]ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 145468972) has the molecular formula C28H32N2O3S and a molecular weight of 476.64 g/mol. Its IUPAC name is ethyl (2Z,4E)-5-[2-[1-amino-2-[4-(2-phenylethoxy)phenyl]ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-5-[2-[1-amino-2-[4-(2-phenylethoxy)phenyl]ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 145468972 |
| Molecular Formula | C28H32N2O3S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | ethyl (2Z,4E)-5-[2-[1-amino-2-[4-(2-phenylethoxy)phenyl]ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C\C(C)=C\c1csc(C(N)Cc2ccc(OCCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C28H32N2O3S/c1-4-32-28(31)21(3)16-20(2)17-24-19-34-27(30-24)26(29)18-23-10-12-25(13-11-23)33-15-14-22-8-6-5-7-9-22/h5-13,16-17,19,26H,4,14-15,18,29H2,1-3H3/b20-17+,21-16- |
| InChIKey | NYHSLLZCGNZOAW-OHDIYIDUSA-N |
| XLogP | 5.92 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|