C34H42N3O4S+ — CID 145469002
[(1S)-1-[4-[(1E,3Z)-5-ethoxy-2,4-dimethyl-5-oxopenta-1,3-dienyl]-1,3-thiazol-2-yl]-2-(4-phenylmethoxyphenyl)ethyl]-[(1-methylpiperidin-4-yl)methyl]-oxoazanium (PubChem CID 145469002) has the molecular formula C34H42N3O4S+ and a molecular weight of 588.79 g/mol. Its IUPAC name is [(1S)-1-[4-[(1E,3Z)-5-ethoxy-2,4-dimethyl-5-oxopenta-1,3-dienyl]-1,3-thiazol-2-yl]-2-(4-phenylmethoxyphenyl)ethyl]-[(1-methylpiperidin-4-yl)methyl]-oxoazanium.
| Compound Name | [(1S)-1-[4-[(1E,3Z)-5-ethoxy-2,4-dimethyl-5-oxopenta-1,3-dienyl]-1,3-thiazol-2-yl]-2-(4-phenylmethoxyphenyl)ethyl]-[(1-methylpiperidin-4-yl)methyl]-oxoazanium |
|---|---|
| PubChem CID | 145469002 |
| Molecular Formula | C34H42N3O4S+ |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | [(1S)-1-[4-[(1E,3Z)-5-ethoxy-2,4-dimethyl-5-oxopenta-1,3-dienyl]-1,3-thiazol-2-yl]-2-(4-phenylmethoxyphenyl)ethyl]-[(1-methylpiperidin-4-yl)methyl]-oxoazanium |
| SMILES | CCOC(=O)/C(C)=C\C(C)=C\c1csc([C@H](Cc2ccc(OCc3ccccc3)cc2)[N+](=O)CC2CCN(C)CC2)n1 |
| InChI | InChI=1S/C34H42N3O4S/c1-5-40-34(38)26(3)19-25(2)20-30-24-42-33(35-30)32(37(39)22-28-15-17-36(4)18-16-28)21-27-11-13-31(14-12-27)41-23-29-9-7-6-8-10-29/h6-14,19-20,24,28,32H,5,15-18,21-23H2,1-4H3/q+1/b25-20+,26-19-/t32-/m0/s1 |
| InChIKey | FIOSKBQTBVUZEE-AOWJPKAVSA-N |
| XLogP | 7.04 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|