C27H36N2O3S — CID 145468929
cyclohexanecarbaldehyde;ethyl (2Z,4E)-5-[2-(1-amino-2-phenylethyl)-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 145468929) has the molecular formula C27H36N2O3S and a molecular weight of 468.66 g/mol. Its IUPAC name is cyclohexanecarbaldehyde;ethyl (2Z,4E)-5-[2-(1-amino-2-phenylethyl)-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | cyclohexanecarbaldehyde;ethyl (2Z,4E)-5-[2-(1-amino-2-phenylethyl)-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 145468929 |
| Molecular Formula | C27H36N2O3S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | cyclohexanecarbaldehyde;ethyl (2Z,4E)-5-[2-(1-amino-2-phenylethyl)-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C\C(C)=C\c1csc(C(N)Cc2ccccc2)n1.O=CC1CCCCC1 |
| InChI | InChI=1S/C20H24N2O2S.C7H12O/c1-4-24-20(23)15(3)10-14(2)11-17-13-25-19(22-17)18(21)12-16-8-6-5-7-9-16;8-6-7-4-2-1-3-5-7/h5-11,13,18H,4,12,21H2,1-3H3;6-7H,1-5H2/b14-11+,15-10-; |
| InChIKey | TXYHCXPLDNEXMV-MHBFZGHCSA-N |
| XLogP | 6.06 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|