C33H40N2O4S — CID 145468976
cyclopentanecarbaldehyde;ethyl (2Z,4E)-5-[2-[1-amino-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 145468976) has the molecular formula C33H40N2O4S and a molecular weight of 560.76 g/mol. Its IUPAC name is cyclopentanecarbaldehyde;ethyl (2Z,4E)-5-[2-[1-amino-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | cyclopentanecarbaldehyde;ethyl (2Z,4E)-5-[2-[1-amino-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 145468976 |
| Molecular Formula | C33H40N2O4S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | cyclopentanecarbaldehyde;ethyl (2Z,4E)-5-[2-[1-amino-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C\C(C)=C\c1csc(C(N)Cc2ccc(OCc3ccccc3)cc2)n1.O=CC1CCCC1 |
| InChI | InChI=1S/C27H30N2O3S.C6H10O/c1-4-31-27(30)20(3)14-19(2)15-23-18-33-26(29-23)25(28)16-21-10-12-24(13-11-21)32-17-22-8-6-5-7-9-22;7-5-6-3-1-2-4-6/h5-15,18,25H,4,16-17,28H2,1-3H3;5-6H,1-4H2/b19-15+,20-14-; |
| InChIKey | XBRZZLLXSLODMB-QMVRYOARSA-N |
| XLogP | 7.25 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|