C33H40N2O4S — CID 25012698
ethyl (2Z,4E)-5-[2-[(1S)-1-(3,3-dimethylbutanoylamino)-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 25012698) has the molecular formula C33H40N2O4S and a molecular weight of 560.76 g/mol. Its IUPAC name is ethyl (2Z,4E)-5-[2-[(1S)-1-(3,3-dimethylbutanoylamino)-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-5-[2-[(1S)-1-(3,3-dimethylbutanoylamino)-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 25012698 |
| Molecular Formula | C33H40N2O4S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | ethyl (2Z,4E)-5-[2-[(1S)-1-(3,3-dimethylbutanoylamino)-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C\C(C)=C\c1csc([C@H](Cc2ccc(OCc3ccccc3)cc2)NC(=O)CC(C)(C)C)n1 |
| InChI | InChI=1S/C33H40N2O4S/c1-7-38-32(37)24(3)17-23(2)18-27-22-40-31(34-27)29(35-30(36)20-33(4,5)6)19-25-13-15-28(16-14-25)39-21-26-11-9-8-10-12-26/h8-18,22,29H,7,19-21H2,1-6H3,(H,35,36)/b23-18+,24-17-/t29-/m0/s1 |
| InChIKey | IWIRGEMGQWTINF-QEAQXCLQSA-N |
| XLogP | 7.47 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|