C37H46N2O7S — CID 90666453
(5-ethoxy-5-oxopentyl) (2Z,4E)-2,4-dimethyl-5-[2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoate (PubChem CID 90666453) has the molecular formula C37H46N2O7S and a molecular weight of 662.85 g/mol. Its IUPAC name is (5-ethoxy-5-oxopentyl) (2Z,4E)-2,4-dimethyl-5-[2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoate.
| Compound Name | (5-ethoxy-5-oxopentyl) (2Z,4E)-2,4-dimethyl-5-[2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 90666453 |
| Molecular Formula | C37H46N2O7S |
| Molecular Weight | 662.85 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | (5-ethoxy-5-oxopentyl) (2Z,4E)-2,4-dimethyl-5-[2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoate |
| SMILES | CCOC(=O)CCCCOC(=O)/C(C)=C\C(C)=C\c1csc([C@H](Cc2ccc(OCc3ccccc3)cc2)NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C37H46N2O7S/c1-7-43-33(40)15-11-12-20-44-35(41)27(3)21-26(2)22-30-25-47-34(38-30)32(39-36(42)46-37(4,5)6)23-28-16-18-31(19-17-28)45-24-29-13-9-8-10-14-29/h8-10,13-14,16-19,21-22,25,32H,7,11-12,15,20,23-24H2,1-6H3,(H,39,42)/b26-22+,27-21-/t32-/m0/s1 |
| InChIKey | GQAGWKNKHHXSKY-PLXDIGBBSA-N |
| XLogP | 8.16 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.85 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|