C34H41N3O6S — CID 90666450
methyl 3-[[(2Z,4E)-2,4-dimethyl-5-[2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoyl]amino]propanoate (PubChem CID 90666450) has the molecular formula C34H41N3O6S and a molecular weight of 619.78 g/mol. Its IUPAC name is methyl 3-[[(2Z,4E)-2,4-dimethyl-5-[2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoyl]amino]propanoate.
| Compound Name | methyl 3-[[(2Z,4E)-2,4-dimethyl-5-[2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoyl]amino]propanoate |
|---|---|
| PubChem CID | 90666450 |
| Molecular Formula | C34H41N3O6S |
| Molecular Weight | 619.78 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | methyl 3-[[(2Z,4E)-2,4-dimethyl-5-[2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)/C(C)=C\C(C)=C\c1csc([C@H](Cc2ccc(OCc3ccccc3)cc2)NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C34H41N3O6S/c1-23(18-24(2)31(39)35-17-16-30(38)41-6)19-27-22-44-32(36-27)29(37-33(40)43-34(3,4)5)20-25-12-14-28(15-13-25)42-21-26-10-8-7-9-11-26/h7-15,18-19,22,29H,16-17,20-21H2,1-6H3,(H,35,39)(H,37,40)/b23-19+,24-18-/t29-/m0/s1 |
| InChIKey | AZSSZLKYGUHJOU-QJPLGKTASA-N |
| XLogP | 6.56 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.78 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|