C38H42N2O4S — CID 90710585
ethyl 5-[2-[(1S)-1-(cyclohexanecarbonylamino)-2-[4-(naphthalen-2-ylmethoxy)phenyl]ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 90710585) has the molecular formula C38H42N2O4S and a molecular weight of 622.83 g/mol. Its IUPAC name is ethyl 5-[2-[(1S)-1-(cyclohexanecarbonylamino)-2-[4-(naphthalen-2-ylmethoxy)phenyl]ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | ethyl 5-[2-[(1S)-1-(cyclohexanecarbonylamino)-2-[4-(naphthalen-2-ylmethoxy)phenyl]ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 90710585 |
| Molecular Formula | C38H42N2O4S |
| Molecular Weight | 622.83 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | ethyl 5-[2-[(1S)-1-(cyclohexanecarbonylamino)-2-[4-(naphthalen-2-ylmethoxy)phenyl]ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C(C)=CC(C)=Cc1csc([C@H](Cc2ccc(OCc3ccc4ccccc4c3)cc2)NC(=O)C2CCCCC2)n1 |
| InChI | InChI=1S/C38H42N2O4S/c1-4-43-38(42)27(3)20-26(2)21-33-25-45-37(39-33)35(40-36(41)31-11-6-5-7-12-31)23-28-15-18-34(19-16-28)44-24-29-14-17-30-10-8-9-13-32(30)22-29/h8-10,13-22,25,31,35H,4-7,11-12,23-24H2,1-3H3,(H,40,41)/t35-/m0/s1 |
| InChIKey | RWLJHYBBSNKDNE-DHUJRADRSA-N |
| XLogP | 8.77 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.83 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|