C30H38N2O4S — CID 25014385
ethyl (2Z,4E)-5-[2-[(1S)-1-(cyclohexanecarbonylamino)-2-(4-prop-2-enoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 25014385) has the molecular formula C30H38N2O4S and a molecular weight of 522.71 g/mol. Its IUPAC name is ethyl (2Z,4E)-5-[2-[(1S)-1-(cyclohexanecarbonylamino)-2-(4-prop-2-enoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-5-[2-[(1S)-1-(cyclohexanecarbonylamino)-2-(4-prop-2-enoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 25014385 |
| Molecular Formula | C30H38N2O4S |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | ethyl (2Z,4E)-5-[2-[(1S)-1-(cyclohexanecarbonylamino)-2-(4-prop-2-enoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | C=CCOc1ccc(C[C@H](NC(=O)C2CCCCC2)c2nc(/C=C(C)/C=C(/C)C(=O)OCC)cs2)cc1 |
| InChI | InChI=1S/C30H38N2O4S/c1-5-16-36-26-14-12-23(13-15-26)19-27(32-28(33)24-10-8-7-9-11-24)29-31-25(20-37-29)18-21(3)17-22(4)30(34)35-6-2/h5,12-15,17-18,20,24,27H,1,6-11,16,19H2,2-4H3,(H,32,33)/b21-18+,22-17-/t27-/m0/s1 |
| InChIKey | UFMMKCAQBIVTPM-CUDOFSFRSA-N |
| XLogP | 6.60 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|