C20H24N2O3S — CID 145468950
ethyl (2Z,4E)-5-[2-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 145468950) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is ethyl (2Z,4E)-5-[2-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-5-[2-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 145468950 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | ethyl (2Z,4E)-5-[2-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C\C(C)=C\c1csc(C(N)Cc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C20H24N2O3S/c1-4-25-20(24)14(3)9-13(2)10-16-12-26-19(22-16)18(21)11-15-5-7-17(23)8-6-15/h5-10,12,18,23H,4,11,21H2,1-3H3/b13-10+,14-9- |
| InChIKey | ZOLIDLXMPLEYCV-RWNVEXOMSA-N |
| XLogP | 4.00 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|