C23H28N2O3S — CID 145468956
ethyl (2Z,4E)-5-[2-[1-amino-2-(4-hydroxy-3-prop-2-enylphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 145468956) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is ethyl (2Z,4E)-5-[2-[1-amino-2-(4-hydroxy-3-prop-2-enylphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-5-[2-[1-amino-2-(4-hydroxy-3-prop-2-enylphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 145468956 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | ethyl (2Z,4E)-5-[2-[1-amino-2-(4-hydroxy-3-prop-2-enylphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | C=CCc1cc(CC(N)c2nc(/C=C(C)/C=C(/C)C(=O)OCC)cs2)ccc1O |
| InChI | InChI=1S/C23H28N2O3S/c1-5-7-18-12-17(8-9-21(18)26)13-20(24)22-25-19(14-29-22)11-15(3)10-16(4)23(27)28-6-2/h5,8-12,14,20,26H,1,6-7,13,24H2,2-4H3/b15-11+,16-10- |
| InChIKey | QXEDUOPPKUAOOL-NMDCVMFOSA-N |
| XLogP | 4.73 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|