C34H40N2O4S — CID 145468922
ethyl (2E,4E)-5-[2-[1-(cyclohexanecarbonylamino)-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 145468922) has the molecular formula C34H40N2O4S and a molecular weight of 572.77 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[2-[1-(cyclohexanecarbonylamino)-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[2-[1-(cyclohexanecarbonylamino)-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 145468922 |
| Molecular Formula | C34H40N2O4S |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | ethyl (2E,4E)-5-[2-[1-(cyclohexanecarbonylamino)-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C(C)=C/c1csc(C(Cc2ccc(OCc3ccccc3)cc2)NC(=O)C2CCCCC2)n1 |
| InChI | InChI=1S/C34H40N2O4S/c1-4-39-34(38)25(3)19-24(2)20-29-23-41-33(35-29)31(36-32(37)28-13-9-6-10-14-28)21-26-15-17-30(18-16-26)40-22-27-11-7-5-8-12-27/h5,7-8,11-12,15-20,23,28,31H,4,6,9-10,13-14,21-22H2,1-3H3,(H,36,37)/b24-20+,25-19+ |
| InChIKey | VQFDMIMZQWVEGS-CLUFGAOGSA-N |
| XLogP | 7.62 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|