C35H33FN2O5S — CID 91582391
ethyl 5-[2-[(1S)-1-[[2-(4-fluorophenyl)-2-oxoacetyl]amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate (PubChem CID 91582391) has the molecular formula C35H33FN2O5S and a molecular weight of 612.72 g/mol. Its IUPAC name is ethyl 5-[2-[(1S)-1-[[2-(4-fluorophenyl)-2-oxoacetyl]amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | ethyl 5-[2-[(1S)-1-[[2-(4-fluorophenyl)-2-oxoacetyl]amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 91582391 |
| Molecular Formula | C35H33FN2O5S |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | ethyl 5-[2-[(1S)-1-[[2-(4-fluorophenyl)-2-oxoacetyl]amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C(C)=CC(C)=Cc1csc([C@H](Cc2ccc(OCc3ccccc3)cc2)NC(=O)C(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C35H33FN2O5S/c1-4-42-35(41)24(3)18-23(2)19-29-22-44-34(37-29)31(38-33(40)32(39)27-12-14-28(36)15-13-27)20-25-10-16-30(17-11-25)43-21-26-8-6-5-7-9-26/h5-19,22,31H,4,20-21H2,1-3H3,(H,38,40)/t31-/m0/s1 |
| InChIKey | WMBUZQJXSCMLTR-HKBQPEDESA-N |
| XLogP | 7.06 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|