C35H46N2O4S — CID 145468923
(2Z,4E)-5-[2-[1-amino-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoic acid;2-cyclohexylacetaldehyde;ethane (PubChem CID 145468923) has the molecular formula C35H46N2O4S and a molecular weight of 590.83 g/mol. Its IUPAC name is (2Z,4E)-5-[2-[1-amino-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoic acid;2-cyclohexylacetaldehyde;ethane.
| Compound Name | (2Z,4E)-5-[2-[1-amino-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoic acid;2-cyclohexylacetaldehyde;ethane |
|---|---|
| PubChem CID | 145468923 |
| Molecular Formula | C35H46N2O4S |
| Molecular Weight | 590.83 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | (2Z,4E)-5-[2-[1-amino-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoic acid;2-cyclohexylacetaldehyde;ethane |
| SMILES | C/C(=C/C(C)=C/c1csc(C(N)Cc2ccc(OCc3ccccc3)cc2)n1)C(=O)O.CC.O=CCC1CCCCC1 |
| InChI | InChI=1S/C25H26N2O3S.C8H14O.C2H6/c1-17(12-18(2)25(28)29)13-21-16-31-24(27-21)23(26)14-19-8-10-22(11-9-19)30-15-20-6-4-3-5-7-20;9-7-6-8-4-2-1-3-5-8;1-2/h3-13,16,23H,14-15,26H2,1-2H3,(H,28,29);7-8H,1-6H2;1-2H3/b17-13+,18-12-;; |
| InChIKey | SAGPVCLPQZXHJL-XPCKQNTBSA-N |
| XLogP | 8.58 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.83 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|