C11H15N3S2 — CID 104771044
N-[bis(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine (PubChem CID 104771044) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is N-[bis(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine.
| Compound Name | N-[bis(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 104771044 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-[bis(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1nc(C)cs1)c1nc(C)cs1 |
| InChI | InChI=1S/C11H15N3S2/c1-4-12-9(10-13-7(2)5-15-10)11-14-8(3)6-16-11/h5-6,9,12H,4H2,1-3H3 |
| InChIKey | SNLQTADOHXOPSC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |