C5H9N3S — CID 82417873
2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine (PubChem CID 82417873) has the molecular formula C5H9N3S and a molecular weight of 143.22 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine.
| Compound Name | 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 82417873 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.22 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine |
| SMILES | C[C@H](N)c1ncc(N)s1 |
| InChI | InChI=1S/C5H9N3S/c1-3(6)5-8-2-4(7)9-5/h2-3H,6-7H2,1H3/t3-/m0/s1 |
| InChIKey | GLXGNKBPHNSJCJ-VKHMYHEASA-N |
| XLogP | 0.75 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |