About 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine
2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine (PubChem CID 82417873) has the molecular formula C5H9N3S
and a molecular weight of 143.22 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine |
| PubChem CID | 82417873 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.22 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine |
| SMILES | C[C@H](N)c1ncc(N)s1 |
| InChI | InChI=1S/C5H9N3S/c1-3(6)5-8-2-4(7)9-5/h2-3H,6-7H2,1H3/t3-/m0/s1 |
| InChIKey | GLXGNKBPHNSJCJ-VKHMYHEASA-N |
| XLogP | 0.75 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine?
The IUPAC name of 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine (CID 82417873) is 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine.
What is the SMILES notation for 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine?
The canonical SMILES for 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine is C[C@H](N)c1ncc(N)s1.
What is the InChIKey of 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine?
The InChIKey is GLXGNKBPHNSJCJ-VKHMYHEASA-N. The full InChI is InChI=1S/C5H9N3S/c1-3(6)5-8-2-4(7)9-5/h2-3H,6-7H2,1H3/t3-/m0/s1.
What are the key properties of 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine?
2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine has a molecular weight of 143.22 g/mol, XLogP of 0.75, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-1-aminoethyl]-1,3-thiazol-5-amine is sourced from PubChem (CID 82417873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).