C10H19N3S — CID 102768492
2-N-(3-ethylpentan-2-yl)-1,3-thiazole-2,5-diamine (PubChem CID 102768492) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is 2-N-(3-ethylpentan-2-yl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(3-ethylpentan-2-yl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102768492 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-N-(3-ethylpentan-2-yl)-1,3-thiazole-2,5-diamine |
| SMILES | CCC(CC)C(C)Nc1ncc(N)s1 |
| InChI | InChI=1S/C10H19N3S/c1-4-8(5-2)7(3)13-10-12-6-9(11)14-10/h6-8H,4-5,11H2,1-3H3,(H,12,13) |
| InChIKey | PUGSHHXDVZUQNA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |