C6H11N3OS — CID 102767605
2-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol (PubChem CID 102767605) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is 2-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol.
| Compound Name | 2-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 102767605 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 2-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol |
| SMILES | CC(CO)Nc1ncc(N)s1 |
| InChI | InChI=1S/C6H11N3OS/c1-4(3-10)9-6-8-2-5(7)11-6/h2,4,10H,3,7H2,1H3,(H,8,9) |
| InChIKey | JRKSBUJDLUPVLW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |