C8H14N4OS — CID 106344040
2-[(5-amino-1,3-thiazol-2-yl)amino]-3-methylbutanamide (PubChem CID 106344040) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-[(5-amino-1,3-thiazol-2-yl)amino]-3-methylbutanamide.
| Compound Name | 2-[(5-amino-1,3-thiazol-2-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106344040 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-[(5-amino-1,3-thiazol-2-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)C(Nc1ncc(N)s1)C(N)=O |
| InChI | InChI=1S/C8H14N4OS/c1-4(2)6(7(10)13)12-8-11-3-5(9)14-8/h3-4,6H,9H2,1-2H3,(H2,10,13)(H,11,12) |
| InChIKey | YUGJINOCAUJNHS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |