C6H10N4OS — CID 102767632
3-[(5-amino-1,3-thiazol-2-yl)amino]propanamide (PubChem CID 102767632) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is 3-[(5-amino-1,3-thiazol-2-yl)amino]propanamide.
| Compound Name | 3-[(5-amino-1,3-thiazol-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 102767632 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 3-[(5-amino-1,3-thiazol-2-yl)amino]propanamide |
| SMILES | NC(=O)CCNc1ncc(N)s1 |
| InChI | InChI=1S/C6H10N4OS/c7-4(11)1-2-9-6-10-3-5(8)12-6/h3H,1-2,8H2,(H2,7,11)(H,9,10) |
| InChIKey | GOSDRVFMEZVUIF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |