C7H13N3O2S — CID 102768305
2-[2-[(5-amino-1,3-thiazol-2-yl)amino]ethoxy]ethanol (PubChem CID 102768305) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is 2-[2-[(5-amino-1,3-thiazol-2-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(5-amino-1,3-thiazol-2-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 102768305 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2-[2-[(5-amino-1,3-thiazol-2-yl)amino]ethoxy]ethanol |
| SMILES | Nc1cnc(NCCOCCO)s1 |
| InChI | InChI=1S/C7H13N3O2S/c8-6-5-10-7(13-6)9-1-3-12-4-2-11/h5,11H,1-4,8H2,(H,9,10) |
| InChIKey | XICCVALEFFOPIP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|