C8H13N3S — CID 102769013
2-N-[(E)-pent-3-enyl]-1,3-thiazole-2,5-diamine (PubChem CID 102769013) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 2-N-[(E)-pent-3-enyl]-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-[(E)-pent-3-enyl]-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102769013 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-N-[(E)-pent-3-enyl]-1,3-thiazole-2,5-diamine |
| SMILES | C/C=C/CCNc1ncc(N)s1 |
| InChI | InChI=1S/C8H13N3S/c1-2-3-4-5-10-8-11-6-7(9)12-8/h2-3,6H,4-5,9H2,1H3,(H,10,11)/b3-2+ |
| InChIKey | WBALIBXWEKLSSA-NSCUHMNNSA-N |
| XLogP | 2.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|