C9H13N5S — CID 102769078
2-N-[3-(1H-imidazol-2-yl)propyl]-1,3-thiazole-2,5-diamine (PubChem CID 102769078) has the molecular formula C9H13N5S and a molecular weight of 223.31 g/mol. Its IUPAC name is 2-N-[3-(1H-imidazol-2-yl)propyl]-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-[3-(1H-imidazol-2-yl)propyl]-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102769078 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-N-[3-(1H-imidazol-2-yl)propyl]-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(NCCCc2ncc[nH]2)s1 |
| InChI | InChI=1S/C9H13N5S/c10-7-6-14-9(15-7)13-3-1-2-8-11-4-5-12-8/h4-6H,1-3,10H2,(H,11,12)(H,13,14) |
| InChIKey | LXKUYHFWYCGMNL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|