C13H14ClN5S — CID 106196384
2-chloro-N-[3-(1H-imidazol-2-yl)propyl]-6-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 106196384) has the molecular formula C13H14ClN5S and a molecular weight of 307.81 g/mol. Its IUPAC name is 2-chloro-N-[3-(1H-imidazol-2-yl)propyl]-6-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[3-(1H-imidazol-2-yl)propyl]-6-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106196384 |
| Molecular Formula | C13H14ClN5S |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2-chloro-N-[3-(1H-imidazol-2-yl)propyl]-6-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(NCCCc3ncc[nH]3)nc(Cl)nc2s1 |
| InChI | InChI=1S/C13H14ClN5S/c1-8-7-9-11(18-13(14)19-12(9)20-8)17-4-2-3-10-15-5-6-16-10/h5-7H,2-4H2,1H3,(H,15,16)(H,17,18,19) |
| InChIKey | KISSVXNVSXOZDG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|