C11H11Cl3N4 — CID 114156826
3,5,6-trichloro-N-[3-(1H-imidazol-2-yl)propyl]pyridin-2-amine (PubChem CID 114156826) has the molecular formula C11H11Cl3N4 and a molecular weight of 305.60 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[3-(1H-imidazol-2-yl)propyl]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[3-(1H-imidazol-2-yl)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 114156826 |
| Molecular Formula | C11H11Cl3N4 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 3,5,6-trichloro-N-[3-(1H-imidazol-2-yl)propyl]pyridin-2-amine |
| SMILES | Clc1cc(Cl)c(NCCCc2ncc[nH]2)nc1Cl |
| InChI | InChI=1S/C11H11Cl3N4/c12-7-6-8(13)11(18-10(7)14)17-3-1-2-9-15-4-5-16-9/h4-6H,1-3H2,(H,15,16)(H,17,18) |
| InChIKey | JWWXNGCDJLNSQP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|