C13H18ClN7 — CID 106196401
4-chloro-N-[3-(1H-imidazol-2-yl)propyl]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 106196401) has the molecular formula C13H18ClN7 and a molecular weight of 307.79 g/mol. Its IUPAC name is 4-chloro-N-[3-(1H-imidazol-2-yl)propyl]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-[3-(1H-imidazol-2-yl)propyl]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106196401 |
| Molecular Formula | C13H18ClN7 |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-chloro-N-[3-(1H-imidazol-2-yl)propyl]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(NCCCc2ncc[nH]2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H18ClN7/c14-11-18-12(17-5-3-4-10-15-6-7-16-10)20-13(19-11)21-8-1-2-9-21/h6-7H,1-5,8-9H2,(H,15,16)(H,17,18,19,20) |
| InChIKey | TZHWQDIHGCVXHS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|