C6H11N3OS2 — CID 102769037
2-N-(2-methylsulfinylethyl)-1,3-thiazole-2,5-diamine (PubChem CID 102769037) has the molecular formula C6H11N3OS2 and a molecular weight of 205.31 g/mol. Its IUPAC name is 2-N-(2-methylsulfinylethyl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(2-methylsulfinylethyl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102769037 |
| Molecular Formula | C6H11N3OS2 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 2-N-(2-methylsulfinylethyl)-1,3-thiazole-2,5-diamine |
| SMILES | CS(=O)CCNc1ncc(N)s1 |
| InChI | InChI=1S/C6H11N3OS2/c1-12(10)3-2-8-6-9-4-5(7)11-6/h4H,2-3,7H2,1H3,(H,8,9) |
| InChIKey | SQQOABMZGXRUSU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |