C8H13FN4O2 — CID 80827312
2-[2-[(2-amino-5-fluoropyrimidin-4-yl)amino]ethoxy]ethanol (PubChem CID 80827312) has the molecular formula C8H13FN4O2 and a molecular weight of 216.22 g/mol. Its IUPAC name is 2-[2-[(2-amino-5-fluoropyrimidin-4-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(2-amino-5-fluoropyrimidin-4-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 80827312 |
| Molecular Formula | C8H13FN4O2 |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-[2-[(2-amino-5-fluoropyrimidin-4-yl)amino]ethoxy]ethanol |
| SMILES | Nc1ncc(F)c(NCCOCCO)n1 |
| InChI | InChI=1S/C8H13FN4O2/c9-6-5-12-8(10)13-7(6)11-1-3-15-4-2-14/h5,14H,1-4H2,(H3,10,11,12,13) |
| InChIKey | JYUZVBLKZPGNFY-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|