C11H20FN5 — CID 80777648
4-N-[3-(diethylamino)propyl]-5-fluoropyrimidine-2,4-diamine (PubChem CID 80777648) has the molecular formula C11H20FN5 and a molecular weight of 241.31 g/mol. Its IUPAC name is 4-N-[3-(diethylamino)propyl]-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(diethylamino)propyl]-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80777648 |
| Molecular Formula | C11H20FN5 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 4-N-[3-(diethylamino)propyl]-5-fluoropyrimidine-2,4-diamine |
| SMILES | CCN(CC)CCCNc1nc(N)ncc1F |
| InChI | InChI=1S/C11H20FN5/c1-3-17(4-2)7-5-6-14-10-9(12)8-15-11(13)16-10/h8H,3-7H2,1-2H3,(H3,13,14,15,16) |
| InChIKey | HEWCDTJHRWFLFR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|